C12H11N5 — CID 62303544
2-[4-[(5-aminopyrimidin-2-yl)amino]phenyl]acetonitrile (PubChem CID 62303544) has the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-[4-[(5-aminopyrimidin-2-yl)amino]phenyl]acetonitrile.
| Compound Name | 2-[4-[(5-aminopyrimidin-2-yl)amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 62303544 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-[4-[(5-aminopyrimidin-2-yl)amino]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(Nc2ncc(N)cn2)cc1 |
| InChI | InChI=1S/C12H11N5/c13-6-5-9-1-3-11(4-2-9)17-12-15-7-10(14)8-16-12/h1-4,7-8H,5,14H2,(H,15,16,17) |
| InChIKey | BGNSDLIURLPTJH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |