C23H18N6O2 — CID 74381392
2-(4-cyanoanilino)-6-[4-(2-cyanoethenyl)-2,6-dimethylanilino]pyrimidine-4-carboxylic acid (PubChem CID 74381392) has the molecular formula C23H18N6O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-6-[4-(2-cyanoethenyl)-2,6-dimethylanilino]pyrimidine-4-carboxylic acid.
| Compound Name | 2-(4-cyanoanilino)-6-[4-(2-cyanoethenyl)-2,6-dimethylanilino]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 74381392 |
| Molecular Formula | C23H18N6O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-(4-cyanoanilino)-6-[4-(2-cyanoethenyl)-2,6-dimethylanilino]pyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(C=CC#N)cc(C)c1Nc1cc(C(=O)O)nc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C23H18N6O2/c1-14-10-17(4-3-9-24)11-15(2)21(14)28-20-12-19(22(30)31)27-23(29-20)26-18-7-5-16(13-25)6-8-18/h3-8,10-12H,1-2H3,(H,30,31)(H2,26,27,28,29) |
| InChIKey | JEBVFSKONVKCJU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 134.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|