C27H27N7O3 — CID 158711655
2-(4-cyanoanilino)-N-[3-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)pyrimidine-5-carboxamide (PubChem CID 158711655) has the molecular formula C27H27N7O3 and a molecular weight of 497.56 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-N-[3-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-(4-cyanoanilino)-N-[3-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 158711655 |
| Molecular Formula | C27H27N7O3 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 2-(4-cyanoanilino)-N-[3-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)CCC(=O)Nc1cccc(NC(=O)c2cnc(Nc3ccc(C#N)cc3)nc2NCCC)c1 |
| InChI | InChI=1S/C27H27N7O3/c1-3-14-29-25-23(17-30-27(34-25)33-19-10-8-18(16-28)9-11-19)26(37)32-21-7-5-6-20(15-21)31-24(36)13-12-22(35)4-2/h4-11,15,17H,2-3,12-14H2,1H3,(H,31,36)(H,32,37)(H2,29,30,33,34) |
| InChIKey | FEXUVBYITOZABO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|