C27H30ClN7O3 — CID 147731482
N-[3-chloro-5-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide (PubChem CID 147731482) has the molecular formula C27H30ClN7O3 and a molecular weight of 536.04 g/mol. Its IUPAC name is N-[3-chloro-5-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[3-chloro-5-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 147731482 |
| Molecular Formula | C27H30ClN7O3 |
| Molecular Weight | 536.04 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | N-[3-chloro-5-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)CCC(=O)Nc1cc(Cl)cc(NC(=O)c2cnc(NCCc3ccncc3)nc2NCCC)c1 |
| InChI | InChI=1S/C27H30ClN7O3/c1-3-10-30-25-23(17-32-27(35-25)31-13-9-18-7-11-29-12-8-18)26(38)34-21-15-19(28)14-20(16-21)33-24(37)6-5-22(36)4-2/h4,7-8,11-12,14-17H,2-3,5-6,9-10,13H2,1H3,(H,33,37)(H,34,38)(H2,30,31,32,35) |
| InChIKey | GYMZPFQUCBHXQQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.04 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|