C20H30N8O2 — CID 90052169
N-[3-[(2-aminoacetyl)amino]propyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide (PubChem CID 90052169) has the molecular formula C20H30N8O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[3-[(2-aminoacetyl)amino]propyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[3-[(2-aminoacetyl)amino]propyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90052169 |
| Molecular Formula | C20H30N8O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | N-[3-[(2-aminoacetyl)amino]propyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
| SMILES | CCCNc1nc(NCCc2ccncc2)ncc1C(=O)NCCCNC(=O)CN |
| InChI | InChI=1S/C20H30N8O2/c1-2-7-24-18-16(19(30)25-9-3-8-23-17(29)13-21)14-27-20(28-18)26-12-6-15-4-10-22-11-5-15/h4-5,10-11,14H,2-3,6-9,12-13,21H2,1H3,(H,23,29)(H,25,30)(H2,24,26,27,28) |
| InChIKey | SHZNLJSDGAZGCE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|