C28H34N8O3 — CID 90051827
N-[3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide (PubChem CID 90051827) has the molecular formula C28H34N8O3 and a molecular weight of 530.63 g/mol. Its IUPAC name is N-[3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90051827 |
| Molecular Formula | C28H34N8O3 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | N-[3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)NC(C)(C)C(=O)Nc1cccc(NC(=O)c2cnc(NCCc3ccncc3)nc2NCCC)c1 |
| InChI | InChI=1S/C28H34N8O3/c1-5-13-30-24-22(18-32-27(35-24)31-16-12-19-10-14-29-15-11-19)25(38)33-20-8-7-9-21(17-20)34-26(39)28(3,4)36-23(37)6-2/h6-11,14-15,17-18H,2,5,12-13,16H2,1,3-4H3,(H,33,38)(H,34,39)(H,36,37)(H2,30,31,32,35) |
| InChIKey | SOUUIVFTQJKBQY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|