C29H35N7O3 — CID 152813449
N-[2,4-dimethyl-5-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide (PubChem CID 152813449) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is N-[2,4-dimethyl-5-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[2,4-dimethyl-5-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 152813449 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | N-[2,4-dimethyl-5-(4-oxohex-5-enoylamino)phenyl]-4-(propylamino)-2-(2-pyridin-4-ylethylamino)pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)CCC(=O)Nc1cc(NC(=O)c2cnc(NCCc3ccncc3)nc2NCCC)c(C)cc1C |
| InChI | InChI=1S/C29H35N7O3/c1-5-12-31-27-23(18-33-29(36-27)32-15-11-21-9-13-30-14-10-21)28(39)35-25-17-24(19(3)16-20(25)4)34-26(38)8-7-22(37)6-2/h6,9-10,13-14,16-18H,2,5,7-8,11-12,15H2,1,3-4H3,(H,34,38)(H,35,39)(H2,31,32,33,36) |
| InChIKey | SRUWOLIIBDPREY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|