C23H23N6W- — CID 159566057
4-(4-aminobuta-1,3-dienyl)-2,6-dimethylaniline;4-(4H-pyrimidin-4-id-2-ylamino)benzonitrile;tungsten (PubChem CID 159566057) has the molecular formula C23H23N6W- and a molecular weight of 567.32 g/mol. Its IUPAC name is 4-(4-aminobuta-1,3-dienyl)-2,6-dimethylaniline;4-(4H-pyrimidin-4-id-2-ylamino)benzonitrile;tungsten.
| Compound Name | 4-(4-aminobuta-1,3-dienyl)-2,6-dimethylaniline;4-(4H-pyrimidin-4-id-2-ylamino)benzonitrile;tungsten |
|---|---|
| PubChem CID | 159566057 |
| Molecular Formula | C23H23N6W- |
| Molecular Weight | 567.32 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 4-(4-aminobuta-1,3-dienyl)-2,6-dimethylaniline;4-(4H-pyrimidin-4-id-2-ylamino)benzonitrile;tungsten |
| SMILES | Cc1cc(C=CC=CN)cc(C)c1N.N#Cc1ccc(Nc2n[c-]ccn2)cc1.[W] |
| InChI | InChI=1S/C12H16N2.C11H7N4.W/c1-9-7-11(5-3-4-6-13)8-10(2)12(9)14;12-8-9-2-4-10(5-3-9)15-11-13-6-1-7-14-11;/h3-8H,13-14H2,1-2H3;1-6H,(H,13,14,15);/q;-1; |
| InChIKey | JCLQNUXPKCQJGY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|