C21H18N6 — CID 176542646
4-[[4-[4-(2-iminoethenyl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 176542646) has the molecular formula C21H18N6 and a molecular weight of 354.42 g/mol. Its IUPAC name is 4-[[4-[4-(2-iminoethenyl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-(2-iminoethenyl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 176542646 |
| Molecular Formula | C21H18N6 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-[[4-[4-(2-iminoethenyl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C=C=N)cc(C)c1Nc1ccnc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C21H18N6/c1-14-11-17(7-9-22)12-15(2)20(14)26-19-8-10-24-21(27-19)25-18-5-3-16(13-23)4-6-18/h3-8,10-12,22H,1-2H3,(H2,24,25,26,27) |
| InChIKey | WQMLTOBJMFDCQX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|