C24H24N6 — CID 129095876
4-[[4-[4-(2,5-dihydropyrrol-1-ylmethyl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 129095876) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is 4-[[4-[4-(2,5-dihydropyrrol-1-ylmethyl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-(2,5-dihydropyrrol-1-ylmethyl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 129095876 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 4-[[4-[4-(2,5-dihydropyrrol-1-ylmethyl)-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(CN2CC=CC2)cc(C)c1Nc1ccnc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C24H24N6/c1-17-13-20(16-30-11-3-4-12-30)14-18(2)23(17)28-22-9-10-26-24(29-22)27-21-7-5-19(15-25)6-8-21/h3-10,13-14H,11-12,16H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | MVLMCQBJHTUDBL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|