C12H10N2O — CID 169352776
3-(4-isocyanato-3,5-dimethylphenyl)prop-2-enenitrile (PubChem CID 169352776) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-(4-isocyanato-3,5-dimethylphenyl)prop-2-enenitrile.
| Compound Name | 3-(4-isocyanato-3,5-dimethylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169352776 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-(4-isocyanato-3,5-dimethylphenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C=CC#N)cc(C)c1N=C=O |
| InChI | InChI=1S/C12H10N2O/c1-9-6-11(4-3-5-13)7-10(2)12(9)14-8-15/h3-4,6-7H,1-2H3 |
| InChIKey | VMDPNRZZNNBCBT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|