C19H25NO4 — CID 142598982
(E)-5-[[(E)-3-(3-methoxy-4,5-dimethylphenyl)prop-2-enoyl]amino]-5-methylhex-2-enoic acid (PubChem CID 142598982) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (E)-5-[[(E)-3-(3-methoxy-4,5-dimethylphenyl)prop-2-enoyl]amino]-5-methylhex-2-enoic acid.
| Compound Name | (E)-5-[[(E)-3-(3-methoxy-4,5-dimethylphenyl)prop-2-enoyl]amino]-5-methylhex-2-enoic acid |
|---|---|
| PubChem CID | 142598982 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (E)-5-[[(E)-3-(3-methoxy-4,5-dimethylphenyl)prop-2-enoyl]amino]-5-methylhex-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)NC(C)(C)C/C=C/C(=O)O)cc(C)c1C |
| InChI | InChI=1S/C19H25NO4/c1-13-11-15(12-16(24-5)14(13)2)8-9-17(21)20-19(3,4)10-6-7-18(22)23/h6-9,11-12H,10H2,1-5H3,(H,20,21)(H,22,23)/b7-6+,9-8+ |
| InChIKey | QPHRYGNOECSMEU-BLHCBFLLSA-N |
| XLogP | 3.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|