C15H18O3 — CID 146846078
(1E,4E)-1-(4-hydroxy-3-methoxy-5-methylphenyl)hepta-1,4-dien-3-one (PubChem CID 146846078) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1E,4E)-1-(4-hydroxy-3-methoxy-5-methylphenyl)hepta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(4-hydroxy-3-methoxy-5-methylphenyl)hepta-1,4-dien-3-one |
|---|---|
| PubChem CID | 146846078 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (1E,4E)-1-(4-hydroxy-3-methoxy-5-methylphenyl)hepta-1,4-dien-3-one |
| SMILES | CC/C=C/C(=O)/C=C/c1cc(C)c(O)c(OC)c1 |
| InChI | InChI=1S/C15H18O3/c1-4-5-6-13(16)8-7-12-9-11(2)15(17)14(10-12)18-3/h5-10,17H,4H2,1-3H3/b6-5+,8-7+ |
| InChIKey | SHCIXURTURUEOX-BSWSSELBSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|