C29H29P — CID 91183507
5-ethenyl-1,2,3-trimethylbenzene;triphenylphosphane (PubChem CID 91183507) has the molecular formula C29H29P and a molecular weight of 408.53 g/mol. Its IUPAC name is 5-ethenyl-1,2,3-trimethylbenzene;triphenylphosphane.
| Compound Name | 5-ethenyl-1,2,3-trimethylbenzene;triphenylphosphane |
|---|---|
| PubChem CID | 91183507 |
| Molecular Formula | C29H29P |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 5-ethenyl-1,2,3-trimethylbenzene;triphenylphosphane |
| SMILES | C=Cc1cc(C)c(C)c(C)c1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C11H14/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5-11-6-8(2)10(4)9(3)7-11/h1-15H;5-7H,1H2,2-4H3 |
| InChIKey | FNJLDUQHZDUZKD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|