About ethene;platinum;triphenylphosphane
ethene;platinum;triphenylphosphane (PubChem CID 11071312) has the molecular formula C22H23PPt
and a molecular weight of 513.48 g/mol. Its IUPAC name is ethene;platinum;triphenylphosphane.
Molecular Properties
| Compound Name | ethene;platinum;triphenylphosphane |
| PubChem CID | 11071312 |
| Molecular Formula | C22H23PPt |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | ethene;platinum;triphenylphosphane |
| SMILES | C=C.C=C.[Pt].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2C2H4.Pt/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2;/h1-15H;2*1-2H2; |
| InChIKey | DEJALOCFHMMDJR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethene;platinum;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;platinum;triphenylphosphane?
The IUPAC name of ethene;platinum;triphenylphosphane (CID 11071312) is ethene;platinum;triphenylphosphane.
What is the SMILES notation for ethene;platinum;triphenylphosphane?
The canonical SMILES for ethene;platinum;triphenylphosphane is C=C.C=C.[Pt].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of ethene;platinum;triphenylphosphane?
The InChIKey is DEJALOCFHMMDJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.2C2H4.Pt/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2;/h1-15H;2*1-2H2;.
What are the key properties of ethene;platinum;triphenylphosphane?
ethene;platinum;triphenylphosphane has a molecular weight of 513.48 g/mol, XLogP of 5.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;platinum;triphenylphosphane is sourced from PubChem (CID 11071312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).