C42H40P2 — CID 10282339
[2-(6-diphenylphosphanyl-2,3,4-trimethylphenyl)-3,4,5-trimethylphenyl]-diphenylphosphane (PubChem CID 10282339) has the molecular formula C42H40P2 and a molecular weight of 606.73 g/mol. Its IUPAC name is [2-(6-diphenylphosphanyl-2,3,4-trimethylphenyl)-3,4,5-trimethylphenyl]-diphenylphosphane.
| Compound Name | [2-(6-diphenylphosphanyl-2,3,4-trimethylphenyl)-3,4,5-trimethylphenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 10282339 |
| Molecular Formula | C42H40P2 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | [2-(6-diphenylphosphanyl-2,3,4-trimethylphenyl)-3,4,5-trimethylphenyl]-diphenylphosphane |
| SMILES | Cc1cc(P(c2ccccc2)c2ccccc2)c(-c2c(P(c3ccccc3)c3ccccc3)cc(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C42H40P2/c1-29-27-39(43(35-19-11-7-12-20-35)36-21-13-8-14-22-36)41(33(5)31(29)3)42-34(6)32(4)30(2)28-40(42)44(37-23-15-9-16-24-37)38-25-17-10-18-26-38/h7-28H,1-6H3 |
| InChIKey | YFTPWWOBSWZADV-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|