About (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium
(2-diphenylphosphanylphenyl)-diphenylphosphane;titanium (PubChem CID 174974517) has the molecular formula C30H24P2Ti
and a molecular weight of 494.34 g/mol. Its IUPAC name is (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium.
Molecular Properties
| Compound Name | (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium |
| PubChem CID | 174974517 |
| Molecular Formula | C30H24P2Ti |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium |
| SMILES | [Ti].c1ccc(P(c2ccccc2)c2ccccc2P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24P2.Ti/c1-5-15-25(16-6-1)31(26-17-7-2-8-18-26)29-23-13-14-24-30(29)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28;/h1-24H; |
| InChIKey | RESJBJRLRMMTCO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium?
The IUPAC name of (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium (CID 174974517) is (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium.
What is the SMILES notation for (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium?
The canonical SMILES for (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium is [Ti].c1ccc(P(c2ccccc2)c2ccccc2P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium?
The InChIKey is RESJBJRLRMMTCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24P2.Ti/c1-5-15-25(16-6-1)31(26-17-7-2-8-18-26)29-23-13-14-24-30(29)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28;/h1-24H;.
What are the key properties of (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium?
(2-diphenylphosphanylphenyl)-diphenylphosphane;titanium has a molecular weight of 494.34 g/mol, XLogP of 5.20, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-diphenylphosphanylphenyl)-diphenylphosphane;titanium is sourced from PubChem (CID 174974517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).