About methane;palladium;triphenylphosphane
methane;palladium;triphenylphosphane (PubChem CID 90407786) has the molecular formula C19H19PPd
and a molecular weight of 384.76 g/mol. Its IUPAC name is methane;palladium;triphenylphosphane.
Molecular Properties
| Compound Name | methane;palladium;triphenylphosphane |
| PubChem CID | 90407786 |
| Molecular Formula | C19H19PPd |
| Molecular Weight | 384.76 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | methane;palladium;triphenylphosphane |
| SMILES | C.[Pd].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.CH4.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;1H4; |
| InChIKey | VQEAMZLAFQUIMF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methane;palladium;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;palladium;triphenylphosphane?
The IUPAC name of methane;palladium;triphenylphosphane (CID 90407786) is methane;palladium;triphenylphosphane.
What is the SMILES notation for methane;palladium;triphenylphosphane?
The canonical SMILES for methane;palladium;triphenylphosphane is C.[Pd].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of methane;palladium;triphenylphosphane?
The InChIKey is VQEAMZLAFQUIMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.CH4.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;1H4;.
What are the key properties of methane;palladium;triphenylphosphane?
methane;palladium;triphenylphosphane has a molecular weight of 384.76 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;palladium;triphenylphosphane is sourced from PubChem (CID 90407786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).