About palladium;ruthenium;triphenylphosphane
palladium;ruthenium;triphenylphosphane (PubChem CID 174683160) has the molecular formula C18H15PPdRu
and a molecular weight of 469.78 g/mol. Its IUPAC name is palladium;ruthenium;triphenylphosphane.
Molecular Properties
| Compound Name | palladium;ruthenium;triphenylphosphane |
| PubChem CID | 174683160 |
| Molecular Formula | C18H15PPdRu |
| Molecular Weight | 469.78 g/mol |
| Exact Mass | 469.90 |
| IUPAC Name | palladium;ruthenium;triphenylphosphane |
| SMILES | [Pd].[Ru].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.Pd.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;; |
| InChIKey | KYPUBMKEMVEFGM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.78 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium;ruthenium;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;ruthenium;triphenylphosphane?
The IUPAC name of palladium;ruthenium;triphenylphosphane (CID 174683160) is palladium;ruthenium;triphenylphosphane.
What is the SMILES notation for palladium;ruthenium;triphenylphosphane?
The canonical SMILES for palladium;ruthenium;triphenylphosphane is [Pd].[Ru].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of palladium;ruthenium;triphenylphosphane?
The InChIKey is KYPUBMKEMVEFGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.Pd.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;;.
What are the key properties of palladium;ruthenium;triphenylphosphane?
palladium;ruthenium;triphenylphosphane has a molecular weight of 469.78 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;ruthenium;triphenylphosphane is sourced from PubChem (CID 174683160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).