C12H18O — CID 162197138
formaldehyde;1,2,3,4,5-pentamethylbenzene (PubChem CID 162197138) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is formaldehyde;1,2,3,4,5-pentamethylbenzene.
| Compound Name | formaldehyde;1,2,3,4,5-pentamethylbenzene |
|---|---|
| PubChem CID | 162197138 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | formaldehyde;1,2,3,4,5-pentamethylbenzene |
| SMILES | C=O.Cc1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C11H16.CH2O/c1-7-6-8(2)10(4)11(5)9(7)3;1-2/h6H,1-5H3;1H2 |
| InChIKey | ZRBZDHIHXFJIHJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |