C27H46 — CID 159634644
1,4-dimethylcyclohexane;1-methyl-4-methylidenecyclohexane;1,2,3,4,5-pentamethylbenzene (PubChem CID 159634644) has the molecular formula C27H46 and a molecular weight of 370.67 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane;1-methyl-4-methylidenecyclohexane;1,2,3,4,5-pentamethylbenzene.
| Compound Name | 1,4-dimethylcyclohexane;1-methyl-4-methylidenecyclohexane;1,2,3,4,5-pentamethylbenzene |
|---|---|
| PubChem CID | 159634644 |
| Molecular Formula | C27H46 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.36 |
| IUPAC Name | 1,4-dimethylcyclohexane;1-methyl-4-methylidenecyclohexane;1,2,3,4,5-pentamethylbenzene |
| SMILES | C=C1CCC(C)CC1.CC1CCC(C)CC1.Cc1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C11H16.C8H16.C8H14/c1-7-6-8(2)10(4)11(5)9(7)3;2*1-7-3-5-8(2)6-4-7/h6H,1-5H3;7-8H,3-6H2,1-2H3;8H,1,3-6H2,2H3 |
| InChIKey | MPORJCRMVJRQCR-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|