C15H22 — CID 22888683
2,5,6,7,8-pentamethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 22888683) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 2,5,6,7,8-pentamethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2,5,6,7,8-pentamethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 22888683 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2,5,6,7,8-pentamethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1c(C)c(C)c2c(c1C)CCC(C)C2 |
| InChI | InChI=1S/C15H22/c1-9-6-7-14-12(4)10(2)11(3)13(5)15(14)8-9/h9H,6-8H2,1-5H3 |
| InChIKey | UIEIOSZGBJZASQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |