C42H56 — CID 158290232
1,2,3,7,8-pentamethylnaphthalene;2,6,7,8-tetramethyl-1,2,3,4-tetrahydronaphthalene;2,5,6-trimethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 158290232) has the molecular formula C42H56 and a molecular weight of 560.91 g/mol. Its IUPAC name is 1,2,3,7,8-pentamethylnaphthalene;2,6,7,8-tetramethyl-1,2,3,4-tetrahydronaphthalene;2,5,6-trimethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1,2,3,7,8-pentamethylnaphthalene;2,6,7,8-tetramethyl-1,2,3,4-tetrahydronaphthalene;2,5,6-trimethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 158290232 |
| Molecular Formula | C42H56 |
| Molecular Weight | 560.91 g/mol |
| Exact Mass | 560.44 |
| IUPAC Name | 1,2,3,7,8-pentamethylnaphthalene;2,6,7,8-tetramethyl-1,2,3,4-tetrahydronaphthalene;2,5,6-trimethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1cc2c(c(C)c1C)CC(C)CC2.Cc1cc2ccc(C)c(C)c2c(C)c1C.Cc1ccc2c(c1C)CCC(C)C2 |
| InChI | InChI=1S/C15H18.C14H20.C13H18/c1-9-6-7-14-8-10(2)11(3)13(5)15(14)12(9)4;1-9-5-6-13-8-10(2)11(3)12(4)14(13)7-9;1-9-4-7-13-11(3)10(2)5-6-12(13)8-9/h6-8H,1-5H3;8-9H,5-7H2,1-4H3;5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | GLGJTTXKOXFOPF-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.91 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |