C16H17F — CID 21032941
6-fluoro-2,7-dimethyl-1,2,3,4-tetrahydrophenanthrene (PubChem CID 21032941) has the molecular formula C16H17F and a molecular weight of 228.31 g/mol. Its IUPAC name is 6-fluoro-2,7-dimethyl-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | 6-fluoro-2,7-dimethyl-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 21032941 |
| Molecular Formula | C16H17F |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 6-fluoro-2,7-dimethyl-1,2,3,4-tetrahydrophenanthrene |
| SMILES | Cc1cc2ccc3c(c2cc1F)CCC(C)C3 |
| InChI | InChI=1S/C16H17F/c1-10-3-6-14-12(7-10)4-5-13-8-11(2)16(17)9-15(13)14/h4-5,8-10H,3,6-7H2,1-2H3 |
| InChIKey | BPSBNUYHTGBDIB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |