C18H34 — CID 145046662
2,7-dimethyl-1,2,3,4-tetrahydronaphthalene;ethane (PubChem CID 145046662) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 2,7-dimethyl-1,2,3,4-tetrahydronaphthalene;ethane.
| Compound Name | 2,7-dimethyl-1,2,3,4-tetrahydronaphthalene;ethane |
|---|---|
| PubChem CID | 145046662 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 2,7-dimethyl-1,2,3,4-tetrahydronaphthalene;ethane |
| SMILES | CC.CC.CC.Cc1ccc2c(c1)CC(C)CC2 |
| InChI | InChI=1S/C12H16.3C2H6/c1-9-3-5-11-6-4-10(2)8-12(11)7-9;3*1-2/h3,5,7,10H,4,6,8H2,1-2H3;3*1-2H3 |
| InChIKey | ISVHMSHMTYXKHR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |