C12H17N — CID 143968743
N,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-amine (PubChem CID 143968743) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is N,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-amine.
| Compound Name | N,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 143968743 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-amine |
| SMILES | CNc1ccc2c(c1)CC(C)CC2 |
| InChI | InChI=1S/C12H17N/c1-9-3-4-10-5-6-12(13-2)8-11(10)7-9/h5-6,8-9,13H,3-4,7H2,1-2H3 |
| InChIKey | WBOZSDSCULLWDE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |