C14H24N2 — CID 144877462
ethane;(6-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)hydrazine (PubChem CID 144877462) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;(6-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)hydrazine.
| Compound Name | ethane;(6-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)hydrazine |
|---|---|
| PubChem CID | 144877462 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | ethane;(6-methyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)hydrazine |
| SMILES | CC.CC1CCCc2cc(NN)ccc2C1 |
| InChI | InChI=1S/C12H18N2.C2H6/c1-9-3-2-4-10-8-12(14-13)6-5-11(10)7-9;1-2/h5-6,8-9,14H,2-4,7,13H2,1H3;1-2H3 |
| InChIKey | VEJKTIAGSBWSIV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|