C10H14N2O — CID 123304229
7-(methylamino)-1,2,3,4-tetrahydroquinolin-2-ol (PubChem CID 123304229) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 7-(methylamino)-1,2,3,4-tetrahydroquinolin-2-ol.
| Compound Name | 7-(methylamino)-1,2,3,4-tetrahydroquinolin-2-ol |
|---|---|
| PubChem CID | 123304229 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 7-(methylamino)-1,2,3,4-tetrahydroquinolin-2-ol |
| SMILES | CNc1ccc2c(c1)NC(O)CC2 |
| InChI | InChI=1S/C10H14N2O/c1-11-8-4-2-7-3-5-10(13)12-9(7)6-8/h2,4,6,10-13H,3,5H2,1H3 |
| InChIKey | FLGIFUZMQPHAED-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |