About 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene
6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 150751811) has the molecular formula C11H12Cl2
and a molecular weight of 215.12 g/mol. Its IUPAC name is 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene.
Analyze 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene?
The IUPAC name of 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene (CID 150751811) is 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene.
What is the SMILES notation for 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene?
The canonical SMILES for 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene is CC1CCc2cc(Cl)c(Cl)cc2C1.
What is the InChIKey of 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene?
The InChIKey is JWAHXWWPHJJGRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2/c1-7-2-3-8-5-10(12)11(13)6-9(8)4-7/h5-7H,2-4H2,1H3.
What are the key properties of 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene?
6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene has a molecular weight of 215.12 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-2-methyl-1,2,3,4-tetrahydronaphthalene is sourced from PubChem (CID 150751811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).