C13H17NO — CID 101229888
N-[(2R)-7-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide (PubChem CID 101229888) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is N-[(2R)-7-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide.
| Compound Name | N-[(2R)-7-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 101229888 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-[(2R)-7-methyl-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCc2ccc(C)cc2C1 |
| InChI | InChI=1S/C13H17NO/c1-9-3-4-11-5-6-13(14-10(2)15)8-12(11)7-9/h3-4,7,13H,5-6,8H2,1-2H3,(H,14,15)/t13-/m1/s1 |
| InChIKey | YHPYIYZGNXDISB-CYBMUJFWSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |