C12H12N2O — CID 163915439
N-(5-cyano-2,3-dihydro-1H-inden-2-yl)acetamide (PubChem CID 163915439) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is N-(5-cyano-2,3-dihydro-1H-inden-2-yl)acetamide.
| Compound Name | N-(5-cyano-2,3-dihydro-1H-inden-2-yl)acetamide |
|---|---|
| PubChem CID | 163915439 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | N-(5-cyano-2,3-dihydro-1H-inden-2-yl)acetamide |
| SMILES | CC(=O)NC1Cc2ccc(C#N)cc2C1 |
| InChI | InChI=1S/C12H12N2O/c1-8(15)14-12-5-10-3-2-9(7-13)4-11(10)6-12/h2-4,12H,5-6H2,1H3,(H,14,15) |
| InChIKey | UTLRLPYMUQQZJI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |