C18H15N3O2 — CID 143265631
N-(6-cyano-1,2,3,4-tetrahydroquinolin-3-yl)-2-oxo-2-phenylacetamide (PubChem CID 143265631) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is N-(6-cyano-1,2,3,4-tetrahydroquinolin-3-yl)-2-oxo-2-phenylacetamide.
| Compound Name | N-(6-cyano-1,2,3,4-tetrahydroquinolin-3-yl)-2-oxo-2-phenylacetamide |
|---|---|
| PubChem CID | 143265631 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(6-cyano-1,2,3,4-tetrahydroquinolin-3-yl)-2-oxo-2-phenylacetamide |
| SMILES | N#Cc1ccc2c(c1)CC(NC(=O)C(=O)c1ccccc1)CN2 |
| InChI | InChI=1S/C18H15N3O2/c19-10-12-6-7-16-14(8-12)9-15(11-20-16)21-18(23)17(22)13-4-2-1-3-5-13/h1-8,15,20H,9,11H2,(H,21,23) |
| InChIKey | JIRDUGDFSDTUKL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|