C16H15N3O2S — CID 66757946
N-[(3S)-6-cyano-1,2,3,4-tetrahydroquinolin-3-yl]benzenesulfonamide (PubChem CID 66757946) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-[(3S)-6-cyano-1,2,3,4-tetrahydroquinolin-3-yl]benzenesulfonamide.
| Compound Name | N-[(3S)-6-cyano-1,2,3,4-tetrahydroquinolin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 66757946 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-[(3S)-6-cyano-1,2,3,4-tetrahydroquinolin-3-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc2c(c1)C[C@H](NS(=O)(=O)c1ccccc1)CN2 |
| InChI | InChI=1S/C16H15N3O2S/c17-10-12-6-7-16-13(8-12)9-14(11-18-16)19-22(20,21)15-4-2-1-3-5-15/h1-8,14,18-19H,9,11H2/t14-/m0/s1 |
| InChIKey | MHYDATSAXQNFJZ-AWEZNQCLSA-N |
| XLogP | 1.87 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |