C23H22O — CID 174285203
furan;2-methyl-1,2,3,4-tetrahydrochrysene (PubChem CID 174285203) has the molecular formula C23H22O and a molecular weight of 314.43 g/mol. Its IUPAC name is furan;2-methyl-1,2,3,4-tetrahydrochrysene.
| Compound Name | furan;2-methyl-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174285203 |
| Molecular Formula | C23H22O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | furan;2-methyl-1,2,3,4-tetrahydrochrysene |
| SMILES | CC1CCc2c(ccc3c2ccc2ccccc23)C1.c1ccoc1 |
| InChI | InChI=1S/C19H18.C4H4O/c1-13-6-9-17-15(12-13)8-11-18-16-5-3-2-4-14(16)7-10-19(17)18;1-2-4-5-3-1/h2-5,7-8,10-11,13H,6,9,12H2,1H3;1-4H |
| InChIKey | HNCQLRXPGBZLGE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|