C22H20Cl2O2S — CID 174892720
dichloro(oxido)sulfanium;furan;1,2,3,4-tetrahydrochrysene (PubChem CID 174892720) has the molecular formula C22H20Cl2O2S and a molecular weight of 419.37 g/mol. Its IUPAC name is dichloro(oxido)sulfanium;furan;1,2,3,4-tetrahydrochrysene.
| Compound Name | dichloro(oxido)sulfanium;furan;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174892720 |
| Molecular Formula | C22H20Cl2O2S |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | dichloro(oxido)sulfanium;furan;1,2,3,4-tetrahydrochrysene |
| SMILES | [O-][S+](Cl)Cl.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3.c1ccoc1 |
| InChI | InChI=1S/C18H16.C4H4O.Cl2OS/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-5-3-1;1-4(2)3/h1,3,5,7,9-12H,2,4,6,8H2;1-4H; |
| InChIKey | PHCRCDUDLWHPOR-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 36.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|