C23H19NO — CID 174853347
furan;1,2,3,4-tetrahydrochrysene-3-carbonitrile (PubChem CID 174853347) has the molecular formula C23H19NO and a molecular weight of 325.41 g/mol. Its IUPAC name is furan;1,2,3,4-tetrahydrochrysene-3-carbonitrile.
| Compound Name | furan;1,2,3,4-tetrahydrochrysene-3-carbonitrile |
|---|---|
| PubChem CID | 174853347 |
| Molecular Formula | C23H19NO |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | furan;1,2,3,4-tetrahydrochrysene-3-carbonitrile |
| SMILES | N#CC1CCc2ccc3c(ccc4ccccc43)c2C1.c1ccoc1 |
| InChI | InChI=1S/C19H15N.C4H4O/c20-12-13-5-6-15-8-9-17-16-4-2-1-3-14(16)7-10-18(17)19(15)11-13;1-2-4-5-3-1/h1-4,7-10,13H,5-6,11H2;1-4H |
| InChIKey | AMDCUFFTFVWYMQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|