C19H17Br — CID 174528135
3-(bromomethyl)-1,2,3,4-tetrahydrochrysene (PubChem CID 174528135) has the molecular formula C19H17Br and a molecular weight of 325.25 g/mol. Its IUPAC name is 3-(bromomethyl)-1,2,3,4-tetrahydrochrysene.
| Compound Name | 3-(bromomethyl)-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174528135 |
| Molecular Formula | C19H17Br |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-(bromomethyl)-1,2,3,4-tetrahydrochrysene |
| SMILES | BrCC1CCc2ccc3c(ccc4ccccc43)c2C1 |
| InChI | InChI=1S/C19H17Br/c20-12-13-5-6-15-8-9-17-16-4-2-1-3-14(16)7-10-18(17)19(15)11-13/h1-4,7-10,13H,5-6,11-12H2 |
| InChIKey | PIDQZBIRLHSCPO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|