C11H14O2 — CID 122378222
3,7-dimethyl-5,6,7,8-tetrahydroisochromen-1-one (PubChem CID 122378222) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 3,7-dimethyl-5,6,7,8-tetrahydroisochromen-1-one.
| Compound Name | 3,7-dimethyl-5,6,7,8-tetrahydroisochromen-1-one |
|---|---|
| PubChem CID | 122378222 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3,7-dimethyl-5,6,7,8-tetrahydroisochromen-1-one |
| SMILES | Cc1cc2c(c(=O)o1)CC(C)CC2 |
| InChI | InChI=1S/C11H14O2/c1-7-3-4-9-6-8(2)13-11(12)10(9)5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZUMXIMAXBPXXSF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |