C10H8O4 — CID 58212109
3,7-dimethylpyrano[4,3-c]pyran-1,5-dione (PubChem CID 58212109) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is 3,7-dimethylpyrano[4,3-c]pyran-1,5-dione.
| Compound Name | 3,7-dimethylpyrano[4,3-c]pyran-1,5-dione |
|---|---|
| PubChem CID | 58212109 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3,7-dimethylpyrano[4,3-c]pyran-1,5-dione |
| SMILES | Cc1cc2c(=O)oc(C)cc2c(=O)o1 |
| InChI | InChI=1S/C10H8O4/c1-5-3-7-8(9(11)13-5)4-6(2)14-10(7)12/h3-4H,1-2H3 |
| InChIKey | OCBXHLQGMCYHPW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |