C24H26F4 — CID 130347361
6-[2-(3,4-difluoro-6-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-7,8-difluoro-2-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 130347361) has the molecular formula C24H26F4 and a molecular weight of 390.46 g/mol. Its IUPAC name is 6-[2-(3,4-difluoro-6-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-7,8-difluoro-2-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[2-(3,4-difluoro-6-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-7,8-difluoro-2-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 130347361 |
| Molecular Formula | C24H26F4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 6-[2-(3,4-difluoro-6-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-7,8-difluoro-2-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC1CCc2cc(CCc3cc4c(c(F)c3F)CC(C)CC4)c(F)c(F)c2C1 |
| InChI | InChI=1S/C24H26F4/c1-13-3-5-15-11-17(21(25)23(27)19(15)9-13)7-8-18-12-16-6-4-14(2)10-20(16)24(28)22(18)26/h11-14H,3-10H2,1-2H3 |
| InChIKey | HEYYPPIIVMNQDM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |