C9H9IO3 — CID 101399804
3-iodo-7-methyl-3,4-dihydro-2H-pyrano[3,2-c]pyran-5-one (PubChem CID 101399804) has the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. Its IUPAC name is 3-iodo-7-methyl-3,4-dihydro-2H-pyrano[3,2-c]pyran-5-one.
| Compound Name | 3-iodo-7-methyl-3,4-dihydro-2H-pyrano[3,2-c]pyran-5-one |
|---|---|
| PubChem CID | 101399804 |
| Molecular Formula | C9H9IO3 |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | 3-iodo-7-methyl-3,4-dihydro-2H-pyrano[3,2-c]pyran-5-one |
| SMILES | Cc1cc2c(c(=O)o1)CC(I)CO2 |
| InChI | InChI=1S/C9H9IO3/c1-5-2-8-7(9(11)13-5)3-6(10)4-12-8/h2,6H,3-4H2,1H3 |
| InChIKey | WEABQUBMCNTBET-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|