C17H24 — CID 162292793
(4aS,9aR)-5,6,7-trimethyl-1,2,3,4,4a,9,9a,10-octahydroanthracene (PubChem CID 162292793) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is (4aS,9aR)-5,6,7-trimethyl-1,2,3,4,4a,9,9a,10-octahydroanthracene.
| Compound Name | (4aS,9aR)-5,6,7-trimethyl-1,2,3,4,4a,9,9a,10-octahydroanthracene |
|---|---|
| PubChem CID | 162292793 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | (4aS,9aR)-5,6,7-trimethyl-1,2,3,4,4a,9,9a,10-octahydroanthracene |
| SMILES | Cc1cc2c(c(C)c1C)C[C@@H]1CCCC[C@@H]1C2 |
| InChI | InChI=1S/C17H24/c1-11-8-16-9-14-6-4-5-7-15(14)10-17(16)13(3)12(11)2/h8,14-15H,4-7,9-10H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | JBKHTLVHWADQNG-CABCVRRESA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |