C12H17N — CID 137470478
5,6,7-trimethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 137470478) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 5,6,7-trimethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5,6,7-trimethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 137470478 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 5,6,7-trimethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1cc2c(c(C)c1C)CCNC2 |
| InChI | InChI=1S/C12H17N/c1-8-6-11-7-13-5-4-12(11)10(3)9(8)2/h6,13H,4-5,7H2,1-3H3 |
| InChIKey | ZJQJHKBLOBRWGR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |