C14H24FN — CID 145372798
ethane;7-fluoro-6-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 145372798) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is ethane;7-fluoro-6-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | ethane;7-fluoro-6-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 145372798 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | ethane;7-fluoro-6-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC.CC.Cc1cc2c(cc1F)CNCC2 |
| InChI | InChI=1S/C10H12FN.2C2H6/c1-7-4-8-2-3-12-6-9(8)5-10(7)11;2*1-2/h4-5,12H,2-3,6H2,1H3;2*1-2H3 |
| InChIKey | UXDOVOJDDPSBMX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |