C11H16ClN — CID 156822930
5-chloro-6-methyl-2,3-dihydro-1H-isoindole;ethane (PubChem CID 156822930) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is 5-chloro-6-methyl-2,3-dihydro-1H-isoindole;ethane.
| Compound Name | 5-chloro-6-methyl-2,3-dihydro-1H-isoindole;ethane |
|---|---|
| PubChem CID | 156822930 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-chloro-6-methyl-2,3-dihydro-1H-isoindole;ethane |
| SMILES | CC.Cc1cc2c(cc1Cl)CNC2 |
| InChI | InChI=1S/C9H10ClN.C2H6/c1-6-2-7-4-11-5-8(7)3-9(6)10;1-2/h2-3,11H,4-5H2,1H3;1-2H3 |
| InChIKey | QEDNEVKFFLOSIJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |