C10H10ClNO2 — CID 141148713
5-chloro-6-methyl-1,3-dihydroisoindole-2-carboxylic acid (PubChem CID 141148713) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 5-chloro-6-methyl-1,3-dihydroisoindole-2-carboxylic acid.
| Compound Name | 5-chloro-6-methyl-1,3-dihydroisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 141148713 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 5-chloro-6-methyl-1,3-dihydroisoindole-2-carboxylic acid |
| SMILES | Cc1cc2c(cc1Cl)CN(C(=O)O)C2 |
| InChI | InChI=1S/C10H10ClNO2/c1-6-2-7-4-12(10(13)14)5-8(7)3-9(6)11/h2-3H,4-5H2,1H3,(H,13,14) |
| InChIKey | JQNXJXGBQXLWBM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |