C13H18FN — CID 130473606
6-tert-butyl-7-fluoro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 130473606) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is 6-tert-butyl-7-fluoro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-tert-butyl-7-fluoro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 130473606 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 6-tert-butyl-7-fluoro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC(C)(C)c1cc2c(cc1F)CNCC2 |
| InChI | InChI=1S/C13H18FN/c1-13(2,3)11-6-9-4-5-15-8-10(9)7-12(11)14/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | MMKLMHNRMBUZTO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |