C8H9Cl3N2 — CID 146013843
5,7-dichloro-1,2,3,4-tetrahydro-2,6-naphthyridine;hydrochloride (PubChem CID 146013843) has the molecular formula C8H9Cl3N2 and a molecular weight of 239.53 g/mol. Its IUPAC name is 5,7-dichloro-1,2,3,4-tetrahydro-2,6-naphthyridine;hydrochloride.
| Compound Name | 5,7-dichloro-1,2,3,4-tetrahydro-2,6-naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 146013843 |
| Molecular Formula | C8H9Cl3N2 |
| Molecular Weight | 239.53 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 5,7-dichloro-1,2,3,4-tetrahydro-2,6-naphthyridine;hydrochloride |
| SMILES | Cl.Clc1cc2c(c(Cl)n1)CCNC2 |
| InChI | InChI=1S/C8H8Cl2N2.ClH/c9-7-3-5-4-11-2-1-6(5)8(10)12-7;/h3,11H,1-2,4H2;1H |
| InChIKey | OWSWRCCXKWYLFC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|