C8H9ClN2 — CID 53435831
5-chloro-1,2,3,4-tetrahydro-2,6-naphthyridine (PubChem CID 53435831) has the molecular formula C8H9ClN2 and a molecular weight of 168.63 g/mol. Its IUPAC name is 5-chloro-1,2,3,4-tetrahydro-2,6-naphthyridine.
| Compound Name | 5-chloro-1,2,3,4-tetrahydro-2,6-naphthyridine |
|---|---|
| PubChem CID | 53435831 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 5-chloro-1,2,3,4-tetrahydro-2,6-naphthyridine |
| SMILES | Clc1nccc2c1CCNC2 |
| InChI | InChI=1S/C8H9ClN2/c9-8-7-2-3-10-5-6(7)1-4-11-8/h1,4,10H,2-3,5H2 |
| InChIKey | MCZZBLVEWFMCAM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|