C10H9F3N2O2 — CID 91007291
5,6,7,8-tetrahydro-2,6-naphthyridin-1-yl 2,2,2-trifluoroacetate (PubChem CID 91007291) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-2,6-naphthyridin-1-yl 2,2,2-trifluoroacetate.
| Compound Name | 5,6,7,8-tetrahydro-2,6-naphthyridin-1-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91007291 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5,6,7,8-tetrahydro-2,6-naphthyridin-1-yl 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1nccc2c1CCNC2)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O2/c11-10(12,13)9(16)17-8-7-2-3-14-5-6(7)1-4-15-8/h1,4,14H,2-3,5H2 |
| InChIKey | GQDXNSCDZGLKFL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |